C12H5F21O — CID 162548788
2,2,3,3,4,4,5,6,6,7,7,8,8,9,9,10,10,11,11,11-icosafluoro-5-(fluoromethyl)undecan-1-ol (PubChem CID 162548788) has the molecular formula C12H5F21O and a molecular weight of 564.13 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,6,6,7,7,8,8,9,9,10,10,11,11,11-icosafluoro-5-(fluoromethyl)undecan-1-ol.
| Compound Name | 2,2,3,3,4,4,5,6,6,7,7,8,8,9,9,10,10,11,11,11-icosafluoro-5-(fluoromethyl)undecan-1-ol |
|---|---|
| PubChem CID | 162548788 |
| Molecular Formula | C12H5F21O |
| Molecular Weight | 564.13 g/mol |
| Exact Mass | 564.00 |
| IUPAC Name | 2,2,3,3,4,4,5,6,6,7,7,8,8,9,9,10,10,11,11,11-icosafluoro-5-(fluoromethyl)undecan-1-ol |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(CF)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H5F21O/c13-1-3(14,5(17,18)7(21,22)4(15,16)2-34)6(19,20)8(23,24)9(25,26)10(27,28)11(29,30)12(31,32)33/h34H,1-2H2 |
| InChIKey | OBWGQSYFSBDAOZ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.13 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|