C6H6F10O2Zn — CID 22386022
bis(2,2,3,3,3-pentafluoropropan-1-ol);zinc (PubChem CID 22386022) has the molecular formula C6H6F10O2Zn and a molecular weight of 365.48 g/mol. Its IUPAC name is bis(2,2,3,3,3-pentafluoropropan-1-ol);zinc.
| Compound Name | bis(2,2,3,3,3-pentafluoropropan-1-ol);zinc |
|---|---|
| PubChem CID | 22386022 |
| Molecular Formula | C6H6F10O2Zn |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | bis(2,2,3,3,3-pentafluoropropan-1-ol);zinc |
| SMILES | OCC(F)(F)C(F)(F)F.OCC(F)(F)C(F)(F)F.[Zn] |
| InChI | InChI=1S/2C3H3F5O.Zn/c2*4-2(5,1-9)3(6,7)8;/h2*9H,1H2; |
| InChIKey | XOJQBUHWNNVYAD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|