C9H3F17O — CID 139794551
2,2,3,3,4,4,5,5,6,6,7,8,8,8-tetradecafluoro-7-(trifluoromethyl)octan-1-ol (PubChem CID 139794551) has the molecular formula C9H3F17O and a molecular weight of 450.09 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,8,8,8-tetradecafluoro-7-(trifluoromethyl)octan-1-ol.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,8,8,8-tetradecafluoro-7-(trifluoromethyl)octan-1-ol |
|---|---|
| PubChem CID | 139794551 |
| Molecular Formula | C9H3F17O |
| Molecular Weight | 450.09 g/mol |
| Exact Mass | 449.99 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,8,8,8-tetradecafluoro-7-(trifluoromethyl)octan-1-ol |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H3F17O/c10-2(11,1-27)4(13,14)6(17,18)7(19,20)5(15,16)3(12,8(21,22)23)9(24,25)26/h27H,1H2 |
| InChIKey | WCXDKGIXGWXVAR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.09 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|