C9H6F14O — CID 91174488
2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorononan-1-ol (PubChem CID 91174488) has the molecular formula C9H6F14O and a molecular weight of 396.12 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorononan-1-ol.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorononan-1-ol |
|---|---|
| PubChem CID | 91174488 |
| Molecular Formula | C9H6F14O |
| Molecular Weight | 396.12 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorononan-1-ol |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CO |
| InChI | InChI=1S/C9H6F14O/c1-3(10,11)5(14,15)7(18,19)9(22,23)8(20,21)6(16,17)4(12,13)2-24/h24H,2H2,1H3 |
| InChIKey | KBJQAXOELLHXNR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.12 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|