C8H8F10O — CID 158825980
2,2,3,3,4,4,5,5,6,6-decafluoro-1-methoxyheptane (PubChem CID 158825980) has the molecular formula C8H8F10O and a molecular weight of 310.13 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoro-1-methoxyheptane.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-methoxyheptane |
|---|---|
| PubChem CID | 158825980 |
| Molecular Formula | C8H8F10O |
| Molecular Weight | 310.13 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-methoxyheptane |
| SMILES | COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C8H8F10O/c1-4(9,10)6(13,14)8(17,18)7(15,16)5(11,12)3-19-2/h3H2,1-2H3 |
| InChIKey | CGBFJVHBMZRIBE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.13 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|