C15H16F18O3Si — CID 54195481
trimethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-octadecafluorododecyl)silane (PubChem CID 54195481) has the molecular formula C15H16F18O3Si and a molecular weight of 614.34 g/mol. Its IUPAC name is trimethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-octadecafluorododecyl)silane.
| Compound Name | trimethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-octadecafluorododecyl)silane |
|---|---|
| PubChem CID | 54195481 |
| Molecular Formula | C15H16F18O3Si |
| Molecular Weight | 614.34 g/mol |
| Exact Mass | 614.06 |
| IUPAC Name | trimethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-octadecafluorododecyl)silane |
| SMILES | CO[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)(F)F)(OC)OC |
| InChI | InChI=1S/C15H16F18O3Si/c1-7(16,17)9(20,21)11(24,25)13(28,29)15(32,33)14(30,31)12(26,27)10(22,23)8(18,19)5-6-37(34-2,35-3)36-4/h5-6H2,1-4H3 |
| InChIKey | QTOXYYXHOUXCII-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.34 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|