C13H16F14O3Si — CID 102247374
trimethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9-tetradecafluorodecyl)silane (PubChem CID 102247374) has the molecular formula C13H16F14O3Si and a molecular weight of 514.33 g/mol. Its IUPAC name is trimethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9-tetradecafluorodecyl)silane.
| Compound Name | trimethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9-tetradecafluorodecyl)silane |
|---|---|
| PubChem CID | 102247374 |
| Molecular Formula | C13H16F14O3Si |
| Molecular Weight | 514.33 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | trimethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9-tetradecafluorodecyl)silane |
| SMILES | CO[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)(F)F)(OC)OC |
| InChI | InChI=1S/C13H16F14O3Si/c1-7(14,15)9(18,19)11(22,23)13(26,27)12(24,25)10(20,21)8(16,17)5-6-31(28-2,29-3)30-4/h5-6H2,1-4H3 |
| InChIKey | RHAXVKORLRCSND-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.33 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|