C10H14F8O — CID 19782043
2,2,3,3,4,4,5,5-octafluoro-1-(2-methylpropoxy)hexane (PubChem CID 19782043) has the molecular formula C10H14F8O and a molecular weight of 302.21 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-1-(2-methylpropoxy)hexane.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-1-(2-methylpropoxy)hexane |
|---|---|
| PubChem CID | 19782043 |
| Molecular Formula | C10H14F8O |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-1-(2-methylpropoxy)hexane |
| SMILES | CC(C)COCC(F)(F)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C10H14F8O/c1-6(2)4-19-5-8(13,14)10(17,18)9(15,16)7(3,11)12/h6H,4-5H2,1-3H3 |
| InChIKey | ZUFDOSFSCQEATD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|