C11H8F12O2 — CID 151064296
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctyl prop-2-enoate (PubChem CID 151064296) has the molecular formula C11H8F12O2 and a molecular weight of 400.16 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctyl prop-2-enoate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctyl prop-2-enoate |
|---|---|
| PubChem CID | 151064296 |
| Molecular Formula | C11H8F12O2 |
| Molecular Weight | 400.16 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorooctyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C11H8F12O2/c1-3-5(24)25-4-7(14,15)9(18,19)11(22,23)10(20,21)8(16,17)6(2,12)13/h3H,1,4H2,2H3 |
| InChIKey | MGUUFSVCDLPBFW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.16 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|