C15H28O2 — CID 88560431
(2-tert-butyl-2,4,4-trimethylpentyl) prop-2-enoate (PubChem CID 88560431) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (2-tert-butyl-2,4,4-trimethylpentyl) prop-2-enoate.
| Compound Name | (2-tert-butyl-2,4,4-trimethylpentyl) prop-2-enoate |
|---|---|
| PubChem CID | 88560431 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (2-tert-butyl-2,4,4-trimethylpentyl) prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H28O2/c1-9-12(16)17-11-15(8,14(5,6)7)10-13(2,3)4/h9H,1,10-11H2,2-8H3 |
| InChIKey | RERNHEJJNOXKQF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|