C10H18F8 — CID 144773774
ethane;2,2,3,3,4,4,5,5-octafluorohexane (PubChem CID 144773774) has the molecular formula C10H18F8 and a molecular weight of 290.24 g/mol. Its IUPAC name is ethane;2,2,3,3,4,4,5,5-octafluorohexane.
| Compound Name | ethane;2,2,3,3,4,4,5,5-octafluorohexane |
|---|---|
| PubChem CID | 144773774 |
| Molecular Formula | C10H18F8 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | ethane;2,2,3,3,4,4,5,5-octafluorohexane |
| SMILES | CC.CC.CC(F)(F)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C6H6F8.2C2H6/c1-3(7,8)5(11,12)6(13,14)4(2,9)10;2*1-2/h1-2H3;2*1-2H3 |
| InChIKey | GQGYJBCWXXVBSC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|