C13H3F26N — CID 90441308
1,1,2,2,3,3,4,4-octafluoro-N,N-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pentan-1-amine (PubChem CID 90441308) has the molecular formula C13H3F26N and a molecular weight of 667.12 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-N,N-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pentan-1-amine.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-N,N-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pentan-1-amine |
|---|---|
| PubChem CID | 90441308 |
| Molecular Formula | C13H3F26N |
| Molecular Weight | 667.12 g/mol |
| Exact Mass | 666.99 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-N,N-bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pentan-1-amine |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(F)N(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H3F26N/c1-2(14,15)3(16,17)6(22,23)11(34,35)40(12(36,37)7(24,25)4(18,19)9(28,29)30)13(38,39)8(26,27)5(20,21)10(31,32)33/h1H3 |
| InChIKey | WNJYMMIZGJDBNK-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.12 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|