C8H12F6 — CID 22568684
1,1,1,2,2,3-hexafluoro-3,4,4-trimethylpentane (PubChem CID 22568684) has the molecular formula C8H12F6 and a molecular weight of 222.17 g/mol. Its IUPAC name is 1,1,1,2,2,3-hexafluoro-3,4,4-trimethylpentane.
| Compound Name | 1,1,1,2,2,3-hexafluoro-3,4,4-trimethylpentane |
|---|---|
| PubChem CID | 22568684 |
| Molecular Formula | C8H12F6 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 1,1,1,2,2,3-hexafluoro-3,4,4-trimethylpentane |
| SMILES | CC(C)(C)C(C)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H12F6/c1-5(2,3)6(4,9)7(10,11)8(12,13)14/h1-4H3 |
| InChIKey | NLKBOTMCFPRFGA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|