C8H9F9 — CID 129191399
1,1,1,2,2,3,3,4,4-nonafluoro-5,5-dimethylhexane (PubChem CID 129191399) has the molecular formula C8H9F9 and a molecular weight of 276.14 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluoro-5,5-dimethylhexane.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluoro-5,5-dimethylhexane |
|---|---|
| PubChem CID | 129191399 |
| Molecular Formula | C8H9F9 |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluoro-5,5-dimethylhexane |
| SMILES | CC(C)(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F9/c1-4(2,3)5(9,10)6(11,12)7(13,14)8(15,16)17/h1-3H3 |
| InChIKey | RRLIIORCXJGDGS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|