C4AlF10 — CID 175811708
CID 175811708 (PubChem CID 175811708) has the molecular formula C4AlF10 and a molecular weight of 265.01 g/mol.
| Compound Name | CID 175811708 |
|---|---|
| PubChem CID | 175811708 |
| Molecular Formula | C4AlF10 |
| Molecular Weight | 265.01 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | — |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Al] |
| InChI | InChI=1S/C4F10.Al/c5-1(6,3(9,10)11)2(7,8)4(12,13)14; |
| InChIKey | LKTNZLOZWHDPHT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.01 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|