C12F26O — CID 13450994
1,1,1,2,2,3,3,4,5,5,6,6,6-tridecafluoro-4-(1,1,1,2,2,3,4,4,5,5,6,6,6-tridecafluorohexan-3-yloxy)hexane (PubChem CID 13450994) has the molecular formula C12F26O and a molecular weight of 654.08 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,5,5,6,6,6-tridecafluoro-4-(1,1,1,2,2,3,4,4,5,5,6,6,6-tridecafluorohexan-3-yloxy)hexane.
| Compound Name | 1,1,1,2,2,3,3,4,5,5,6,6,6-tridecafluoro-4-(1,1,1,2,2,3,4,4,5,5,6,6,6-tridecafluorohexan-3-yloxy)hexane |
|---|---|
| PubChem CID | 13450994 |
| Molecular Formula | C12F26O |
| Molecular Weight | 654.08 g/mol |
| Exact Mass | 653.95 |
| IUPAC Name | 1,1,1,2,2,3,3,4,5,5,6,6,6-tridecafluoro-4-(1,1,1,2,2,3,4,4,5,5,6,6,6-tridecafluorohexan-3-yloxy)hexane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(OC(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12F26O/c13-1(14,3(17,18)9(27,28)29)7(25,5(21,22)11(33,34)35)39-8(26,6(23,24)12(36,37)38)2(15,16)4(19,20)10(30,31)32 |
| InChIKey | PWTUXLZBTRTOMZ-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.08 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|