C10H2F20O — CID 175765305
1,1,1,2,2,3,3,4,4,5,5,6,6,7,8,8,8-heptadecafluoro-7-(1,1,2-trifluoroethoxy)octane (PubChem CID 175765305) has the molecular formula C10H2F20O and a molecular weight of 518.09 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6,7,8,8,8-heptadecafluoro-7-(1,1,2-trifluoroethoxy)octane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,8,8,8-heptadecafluoro-7-(1,1,2-trifluoroethoxy)octane |
|---|---|
| PubChem CID | 175765305 |
| Molecular Formula | C10H2F20O |
| Molecular Weight | 518.09 g/mol |
| Exact Mass | 517.98 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,8,8,8-heptadecafluoro-7-(1,1,2-trifluoroethoxy)octane |
| SMILES | FCC(F)(F)OC(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H2F20O/c11-1-2(12,13)31-8(24,10(28,29)30)6(20,21)4(16,17)3(14,15)5(18,19)7(22,23)9(25,26)27/h1H2 |
| InChIKey | HPWVYYHYMUEHNB-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.09 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|