C12F28O4Si — CID 164522794
1,1,1,2,2,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononan-3-yl tris(trifluoromethyl) silicate (PubChem CID 164522794) has the molecular formula C12F28O4Si and a molecular weight of 768.16 g/mol. Its IUPAC name is 1,1,1,2,2,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononan-3-yl tris(trifluoromethyl) silicate.
| Compound Name | 1,1,1,2,2,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononan-3-yl tris(trifluoromethyl) silicate |
|---|---|
| PubChem CID | 164522794 |
| Molecular Formula | C12F28O4Si |
| Molecular Weight | 768.16 g/mol |
| Exact Mass | 767.91 |
| IUPAC Name | 1,1,1,2,2,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononan-3-yl tris(trifluoromethyl) silicate |
| SMILES | FC(F)(F)O[Si](OC(F)(F)F)(OC(F)(F)F)OC(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12F28O4Si/c13-1(14,3(17,18)5(21,22)8(26,27)28)2(15,16)4(19,20)7(25,6(23,24)9(29,30)31)41-45(42-10(32,33)34,43-11(35,36)37)44-12(38,39)40 |
| InChIKey | UQLCTPSLVAZXKU-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.16 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|