C15H6F30O4Si — CID 174994640
ethanol;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl-tris(trifluoromethoxy)silane (PubChem CID 174994640) has the molecular formula C15H6F30O4Si and a molecular weight of 848.23 g/mol. Its IUPAC name is ethanol;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl-tris(trifluoromethoxy)silane.
| Compound Name | ethanol;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl-tris(trifluoromethoxy)silane |
|---|---|
| PubChem CID | 174994640 |
| Molecular Formula | C15H6F30O4Si |
| Molecular Weight | 848.23 g/mol |
| Exact Mass | 847.96 |
| IUPAC Name | ethanol;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl-tris(trifluoromethoxy)silane |
| SMILES | CCO.FC(F)(F)O[Si](OC(F)(F)F)(OC(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13F30O3Si.C2H6O/c14-1(15,3(18,19)5(22,23)7(26,27)9(30,31)32)2(16,17)4(20,21)6(24,25)8(28,29)10(33,34)47(44-11(35,36)37,45-12(38,39)40)46-13(41,42)43;1-2-3/h;3H,2H2,1H3 |
| InChIKey | RIWAJWQQZDNDQT-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.23 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|