C18H15F25Si — CID 175552208
triethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecyl)silane (PubChem CID 175552208) has the molecular formula C18H15F25Si and a molecular weight of 734.35 g/mol. Its IUPAC name is triethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecyl)silane.
| Compound Name | triethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecyl)silane |
|---|---|
| PubChem CID | 175552208 |
| Molecular Formula | C18H15F25Si |
| Molecular Weight | 734.35 g/mol |
| Exact Mass | 734.05 |
| IUPAC Name | triethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecyl)silane |
| SMILES | CC[Si](CC)(CC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H15F25Si/c1-4-44(5-2,6-3)18(42,43)16(37,38)14(33,34)12(29,30)10(25,26)8(21,22)7(19,20)9(23,24)11(27,28)13(31,32)15(35,36)17(39,40)41/h4-6H2,1-3H3 |
| InChIKey | IGKKGJARXFSTOS-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.35 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|