C22H14F36O3Si — CID 175549890
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl-tris(1,1,2,2,2-pentafluoroethoxy)silane;hexane (PubChem CID 175549890) has the molecular formula C22H14F36O3Si and a molecular weight of 1038.36 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl-tris(1,1,2,2,2-pentafluoroethoxy)silane;hexane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl-tris(1,1,2,2,2-pentafluoroethoxy)silane;hexane |
|---|---|
| PubChem CID | 175549890 |
| Molecular Formula | C22H14F36O3Si |
| Molecular Weight | 1038.36 g/mol |
| Exact Mass | 1038.01 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl-tris(1,1,2,2,2-pentafluoroethoxy)silane;hexane |
| SMILES | CCCCCC.FC(F)(F)C(F)(F)O[Si](OC(F)(F)C(F)(F)F)(OC(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16F36O3Si.C6H14/c17-1(18,3(21,22)5(25,26)7(29,30)9(33,34)35)2(19,20)4(23,24)6(27,28)8(31,32)16(51,52)56(53-13(45,46)10(36,37)38,54-14(47,48)11(39,40)41)55-15(49,50)12(42,43)44;1-3-5-6-4-2/h;3-6H2,1-2H3 |
| InChIKey | UPVZLZJWXADJSG-UHFFFAOYSA-N |
| XLogP | 13.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1038.36 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|