C6F16OSi — CID 172715865
difluoro-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-(1,1,2,2,2-pentafluoroethoxy)silane (PubChem CID 172715865) has the molecular formula C6F16OSi and a molecular weight of 420.12 g/mol. Its IUPAC name is difluoro-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-(1,1,2,2,2-pentafluoroethoxy)silane.
| Compound Name | difluoro-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-(1,1,2,2,2-pentafluoroethoxy)silane |
|---|---|
| PubChem CID | 172715865 |
| Molecular Formula | C6F16OSi |
| Molecular Weight | 420.12 g/mol |
| Exact Mass | 419.95 |
| IUPAC Name | difluoro-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-(1,1,2,2,2-pentafluoroethoxy)silane |
| SMILES | FC(F)(F)C(F)(F)O[Si](F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6F16OSi/c7-1(8,3(11,12)13)2(9,10)6(19,20)24(21,22)23-5(17,18)4(14,15)16 |
| InChIKey | FVXAONYYJVNMDD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.12 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|