C4H6F9N3Si — CID 139751434
1,1,1,2,2,3,3,4,4-nonafluoro-4-triaminosilylbutane (PubChem CID 139751434) has the molecular formula C4H6F9N3Si and a molecular weight of 295.18 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluoro-4-triaminosilylbutane.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluoro-4-triaminosilylbutane |
|---|---|
| PubChem CID | 139751434 |
| Molecular Formula | C4H6F9N3Si |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluoro-4-triaminosilylbutane |
| SMILES | N[Si](N)(N)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H6F9N3Si/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h14-16H2 |
| InChIKey | FFONYNCWPLETQN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|