C16Cl3F33Si — CID 155573710
trichloro(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-tritriacontafluorohexadecyl)silane (PubChem CID 155573710) has the molecular formula C16Cl3F33Si and a molecular weight of 953.55 g/mol. Its IUPAC name is trichloro(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-tritriacontafluorohexadecyl)silane.
| Compound Name | trichloro(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-tritriacontafluorohexadecyl)silane |
|---|---|
| PubChem CID | 155573710 |
| Molecular Formula | C16Cl3F33Si |
| Molecular Weight | 953.55 g/mol |
| Exact Mass | 951.83 |
| IUPAC Name | trichloro(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-tritriacontafluorohexadecyl)silane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C16Cl3F33Si/c17-53(18,19)16(51,52)14(46,47)12(42,43)10(38,39)8(34,35)6(30,31)4(26,27)2(22,23)1(20,21)3(24,25)5(28,29)7(32,33)9(36,37)11(40,41)13(44,45)15(48,49)50 |
| InChIKey | VEHDVLPJHVZPFM-UHFFFAOYSA-N |
| XLogP | 12.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.55 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|