C17Cl2F36Si — CID 90422011
dichloro-fluoro-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-pentatriacontafluoroheptadecyl)silane (PubChem CID 90422011) has the molecular formula C17Cl2F36Si and a molecular weight of 987.11 g/mol. Its IUPAC name is dichloro-fluoro-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-pentatriacontafluoroheptadecyl)silane.
| Compound Name | dichloro-fluoro-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-pentatriacontafluoroheptadecyl)silane |
|---|---|
| PubChem CID | 90422011 |
| Molecular Formula | C17Cl2F36Si |
| Molecular Weight | 987.11 g/mol |
| Exact Mass | 985.86 |
| IUPAC Name | dichloro-fluoro-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-pentatriacontafluoroheptadecyl)silane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[Si](F)(Cl)Cl |
| InChI | InChI=1S/C17Cl2F36Si/c18-56(19,55)17(53,54)15(48,49)13(44,45)11(40,41)9(36,37)7(32,33)5(28,29)3(24,25)1(20,21)2(22,23)4(26,27)6(30,31)8(34,35)10(38,39)12(42,43)14(46,47)16(50,51)52 |
| InChIKey | KLFALRZPFYFBBJ-UHFFFAOYSA-N |
| XLogP | 12.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.11 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|