C20H4F42N2Si — CID 172721781
1-[diamino(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)silyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane (PubChem CID 172721781) has the molecular formula C20H4F42N2Si and a molecular weight of 1098.27 g/mol. Its IUPAC name is 1-[diamino(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)silyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane.
| Compound Name | 1-[diamino(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)silyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane |
|---|---|
| PubChem CID | 172721781 |
| Molecular Formula | C20H4F42N2Si |
| Molecular Weight | 1098.27 g/mol |
| Exact Mass | 1097.95 |
| IUPAC Name | 1-[diamino(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)silyl]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane |
| SMILES | N[Si](N)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H4F42N2Si/c21-1(22,5(29,30)9(37,38)13(45,46)17(53,54)55)3(25,26)7(33,34)11(41,42)15(49,50)19(59,60)65(63,64)20(61,62)16(51,52)12(43,44)8(35,36)4(27,28)2(23,24)6(31,32)10(39,40)14(47,48)18(56,57)58/h63-64H2 |
| InChIKey | GPMUVMDXBXJKIV-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1098.27 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|