C7Cl2F16Si — CID 141389193
dichloro-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-(trifluoromethyl)silane (PubChem CID 141389193) has the molecular formula C7Cl2F16Si and a molecular weight of 487.04 g/mol. Its IUPAC name is dichloro-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-(trifluoromethyl)silane.
| Compound Name | dichloro-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-(trifluoromethyl)silane |
|---|---|
| PubChem CID | 141389193 |
| Molecular Formula | C7Cl2F16Si |
| Molecular Weight | 487.04 g/mol |
| Exact Mass | 485.89 |
| IUPAC Name | dichloro-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-(trifluoromethyl)silane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[Si](Cl)(Cl)C(F)(F)F |
| InChI | InChI=1S/C7Cl2F16Si/c8-26(9,7(23,24)25)6(21,22)4(16,17)2(12,13)1(10,11)3(14,15)5(18,19)20 |
| InChIKey | FHVUSUYNEGFVJQ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.04 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|