C13F30OSi — CID 141429522
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl-(trifluoromethoxy)-bis(trifluoromethyl)silane (PubChem CID 141429522) has the molecular formula C13F30OSi and a molecular weight of 770.17 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl-(trifluoromethoxy)-bis(trifluoromethyl)silane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl-(trifluoromethoxy)-bis(trifluoromethyl)silane |
|---|---|
| PubChem CID | 141429522 |
| Molecular Formula | C13F30OSi |
| Molecular Weight | 770.17 g/mol |
| Exact Mass | 769.92 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl-(trifluoromethoxy)-bis(trifluoromethyl)silane |
| SMILES | FC(F)(F)O[Si](C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13F30OSi/c14-1(15,3(18,19)5(22,23)7(26,27)9(30,31)32)2(16,17)4(20,21)6(24,25)8(28,29)10(33,34)45(12(38,39)40,13(41,42)43)44-11(35,36)37 |
| InChIKey | WRDRHQUGPAATGG-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.17 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|