C14F32O3Si — CID 139908301
1,1,2,2,3,3,3-heptafluoropropyl-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononoxy)-bis(trifluoromethoxy)silane (PubChem CID 139908301) has the molecular formula C14F32O3Si and a molecular weight of 852.17 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoropropyl-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononoxy)-bis(trifluoromethoxy)silane.
| Compound Name | 1,1,2,2,3,3,3-heptafluoropropyl-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononoxy)-bis(trifluoromethoxy)silane |
|---|---|
| PubChem CID | 139908301 |
| Molecular Formula | C14F32O3Si |
| Molecular Weight | 852.17 g/mol |
| Exact Mass | 851.91 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoropropyl-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononoxy)-bis(trifluoromethoxy)silane |
| SMILES | FC(F)(F)O[Si](OC(F)(F)F)(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14F32O3Si/c15-1(16,2(17,18)4(21,22)6(25,26)9(31,32)33)3(19,20)5(23,24)7(27,28)11(37,38)47-50(48-13(41,42)43,49-14(44,45)46)12(39,40)8(29,30)10(34,35)36 |
| InChIKey | HQTVLTWVCGXDDZ-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.17 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|