C16Br2F32 — CID 152609331
1,6-dibromo-1,1,2,2,3,3,4,4,5,5,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-dotriacontafluorohexadecane (PubChem CID 152609331) has the molecular formula C16Br2F32 and a molecular weight of 959.92 g/mol. Its IUPAC name is 1,6-dibromo-1,1,2,2,3,3,4,4,5,5,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-dotriacontafluorohexadecane.
| Compound Name | 1,6-dibromo-1,1,2,2,3,3,4,4,5,5,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-dotriacontafluorohexadecane |
|---|---|
| PubChem CID | 152609331 |
| Molecular Formula | C16Br2F32 |
| Molecular Weight | 959.92 g/mol |
| Exact Mass | 957.79 |
| IUPAC Name | 1,6-dibromo-1,1,2,2,3,3,4,4,5,5,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-dotriacontafluorohexadecane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(Br)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C16Br2F32/c17-1(19,3(22,23)5(26,27)11(38,39)13(42,43)15(18,46)47)2(20,21)4(24,25)6(28,29)7(30,31)8(32,33)9(34,35)10(36,37)12(40,41)14(44,45)16(48,49)50 |
| InChIKey | YZEJFZAAIZHTPA-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.92 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|