C9H4F12S — CID 138676934
1,1,1,2,2,3,3,4,4,5,5,5-dodecafluoropentane;thiophene (PubChem CID 138676934) has the molecular formula C9H4F12S and a molecular weight of 372.17 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,5-dodecafluoropentane;thiophene.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,5-dodecafluoropentane;thiophene |
|---|---|
| PubChem CID | 138676934 |
| Molecular Formula | C9H4F12S |
| Molecular Weight | 372.17 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,5-dodecafluoropentane;thiophene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.c1ccsc1 |
| InChI | InChI=1S/C5F12.C4H4S/c6-1(7,2(8,9)4(12,13)14)3(10,11)5(15,16)17;1-2-4-5-3-1/h;1-4H |
| InChIKey | VDDJPHNXYADEDM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.17 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|