C4HF11 — CID 175814235
1,1,1,2,2,3,3,4,4,4-decafluorobutane;hydrofluoride (PubChem CID 175814235) has the molecular formula C4HF11 and a molecular weight of 258.03 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,4-decafluorobutane;hydrofluoride.
| Compound Name | 1,1,1,2,2,3,3,4,4,4-decafluorobutane;hydrofluoride |
|---|---|
| PubChem CID | 175814235 |
| Molecular Formula | C4HF11 |
| Molecular Weight | 258.03 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,4-decafluorobutane;hydrofluoride |
| SMILES | F.FC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4F10.FH/c5-1(6,3(9,10)11)2(7,8)4(12,13)14;/h;1H |
| InChIKey | DQQSEZFYACJEGB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.03 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|