C11H3F23N+ — CID 22348860
1,1,1,2,2,3,3,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoroundecan-4-ylazanium (PubChem CID 22348860) has the molecular formula C11H3F23N+ and a molecular weight of 586.11 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoroundecan-4-ylazanium.
| Compound Name | 1,1,1,2,2,3,3,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoroundecan-4-ylazanium |
|---|---|
| PubChem CID | 22348860 |
| Molecular Formula | C11H3F23N+ |
| Molecular Weight | 586.11 g/mol |
| Exact Mass | 585.99 |
| IUPAC Name | 1,1,1,2,2,3,3,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoroundecan-4-ylazanium |
| SMILES | [NH3+]C(F)(C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H2F23N/c12-1(13,2(14,15)4(18,19)7(24,25)10(29,30)31)3(16,17)5(20,21)9(28,35)6(22,23)8(26,27)11(32,33)34/h35H2/p+1 |
| InChIKey | JAQRALAIPYCPQC-UHFFFAOYSA-O |
| XLogP | 6.10 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.11 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|