C8F17S — CID 101456345
CID 101456345 (PubChem CID 101456345) has the molecular formula C8F17S and a molecular weight of 451.12 g/mol.
| Compound Name | CID 101456345 |
|---|---|
| PubChem CID | 101456345 |
| Molecular Formula | C8F17S |
| Molecular Weight | 451.12 g/mol |
| Exact Mass | 450.94 |
| IUPAC Name | — |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[S] |
| InChI | InChI=1S/C8F17S/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)26 |
| InChIKey | BSCJJBHEGDRUSW-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.12 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|