C6H2F13P — CID 21095712
1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylphosphane (PubChem CID 21095712) has the molecular formula C6H2F13P and a molecular weight of 352.03 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylphosphane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylphosphane |
|---|---|
| PubChem CID | 21095712 |
| Molecular Formula | C6H2F13P |
| Molecular Weight | 352.03 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylphosphane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)P |
| InChI | InChI=1S/C6H2F13P/c7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)20/h20H2 |
| InChIKey | WINZERXZYUENOL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.03 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|