C8H7F9NO2P — CID 175110172
1,1,2,2,3,3,4,4,4-nonafluorobutylphosphane;pyrrolidine-2,5-dione (PubChem CID 175110172) has the molecular formula C8H7F9NO2P and a molecular weight of 351.11 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutylphosphane;pyrrolidine-2,5-dione.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutylphosphane;pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 175110172 |
| Molecular Formula | C8H7F9NO2P |
| Molecular Weight | 351.11 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutylphosphane;pyrrolidine-2,5-dione |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)P.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C4H2F9P.C4H5NO2/c5-1(6,3(9,10)11)2(7,8)4(12,13)14;6-3-1-2-4(7)5-3/h14H2;1-2H2,(H,5,6,7) |
| InChIKey | QDPDXNYMDDYSOU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.11 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|