C8H5F12NO2P+ — CID 175110171
pyrrolidine-2,5-dione;trifluoro(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phosphanium (PubChem CID 175110171) has the molecular formula C8H5F12NO2P+ and a molecular weight of 406.08 g/mol. Its IUPAC name is pyrrolidine-2,5-dione;trifluoro(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phosphanium.
| Compound Name | pyrrolidine-2,5-dione;trifluoro(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phosphanium |
|---|---|
| PubChem CID | 175110171 |
| Molecular Formula | C8H5F12NO2P+ |
| Molecular Weight | 406.08 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | pyrrolidine-2,5-dione;trifluoro(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phosphanium |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)[P+](F)(F)F.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C4F12P.C4H5NO2/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16;6-3-1-2-4(7)5-3/h;1-2H2,(H,5,6,7)/q+1; |
| InChIKey | MQOCUMIJKIRTJZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.08 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|