C11F23NaO — CID 23682889
sodium 1,1,1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-icosafluoro-2-(trifluoromethyl)decan-2-olate (PubChem CID 23682889) has the molecular formula C11F23NaO and a molecular weight of 608.06 g/mol. Its IUPAC name is sodium 1,1,1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-icosafluoro-2-(trifluoromethyl)decan-2-olate.
| Compound Name | sodium 1,1,1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-icosafluoro-2-(trifluoromethyl)decan-2-olate |
|---|---|
| PubChem CID | 23682889 |
| Molecular Formula | C11F23NaO |
| Molecular Weight | 608.06 g/mol |
| Exact Mass | 607.95 |
| IUPAC Name | sodium 1,1,1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-icosafluoro-2-(trifluoromethyl)decan-2-olate |
| SMILES | [Na+].[O-]C(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11F23O.Na/c12-2(13,1(35,9(26,27)28)10(29,30)31)3(14,15)4(16,17)5(18,19)6(20,21)7(22,23)8(24,25)11(32,33)34;/q-1;+1 |
| InChIKey | KKBIUJNQPZMDBU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.06 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|