C12AsF27 — CID 15800040
tris(1,1,2,2,3,3,4,4,4-nonafluorobutyl)arsane (PubChem CID 15800040) has the molecular formula C12AsF27 and a molecular weight of 732.00 g/mol. Its IUPAC name is tris(1,1,2,2,3,3,4,4,4-nonafluorobutyl)arsane.
| Compound Name | tris(1,1,2,2,3,3,4,4,4-nonafluorobutyl)arsane |
|---|---|
| PubChem CID | 15800040 |
| Molecular Formula | C12AsF27 |
| Molecular Weight | 732.00 g/mol |
| Exact Mass | 731.88 |
| IUPAC Name | tris(1,1,2,2,3,3,4,4,4-nonafluorobutyl)arsane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)[As](C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12AsF27/c14-1(15,4(20,21)10(32,33)34)7(26,27)13(8(28,29)2(16,17)5(22,23)11(35,36)37)9(30,31)3(18,19)6(24,25)12(38,39)40 |
| InChIKey | CVQPKIILJJPJGY-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.00 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|