C10F23N — CID 19898566
1,1,2,2,3,3,4,4,4-nonafluoro-N,N-bis(1,1,2,2,3,3,3-heptafluoropropyl)butan-1-amine (PubChem CID 19898566) has the molecular formula C10F23N and a molecular weight of 571.07 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluoro-N,N-bis(1,1,2,2,3,3,3-heptafluoropropyl)butan-1-amine.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N,N-bis(1,1,2,2,3,3,3-heptafluoropropyl)butan-1-amine |
|---|---|
| PubChem CID | 19898566 |
| Molecular Formula | C10F23N |
| Molecular Weight | 571.07 g/mol |
| Exact Mass | 570.97 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N,N-bis(1,1,2,2,3,3,3-heptafluoropropyl)butan-1-amine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)N(C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10F23N/c11-1(12,5(19,20)21)2(13,14)8(28,29)34(9(30,31)3(15,16)6(22,23)24)10(32,33)4(17,18)7(25,26)27 |
| InChIKey | CJAFXLJLGHAEOC-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.07 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|