C12F27N — CID 18981565
1,1,2,3,3,3-hexafluoro-N,N-bis[1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propyl]-2-(trifluoromethyl)propan-1-amine (PubChem CID 18981565) has the molecular formula C12F27N and a molecular weight of 671.08 g/mol. Its IUPAC name is 1,1,2,3,3,3-hexafluoro-N,N-bis[1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propyl]-2-(trifluoromethyl)propan-1-amine.
| Compound Name | 1,1,2,3,3,3-hexafluoro-N,N-bis[1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propyl]-2-(trifluoromethyl)propan-1-amine |
|---|---|
| PubChem CID | 18981565 |
| Molecular Formula | C12F27N |
| Molecular Weight | 671.08 g/mol |
| Exact Mass | 670.96 |
| IUPAC Name | 1,1,2,3,3,3-hexafluoro-N,N-bis[1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propyl]-2-(trifluoromethyl)propan-1-amine |
| SMILES | FC(F)(F)C(F)(C(F)(F)F)C(F)(F)N(C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12F27N/c13-1(4(16,17)18,5(19,20)21)10(34,35)40(11(36,37)2(14,6(22,23)24)7(25,26)27)12(38,39)3(15,8(28,29)30)9(31,32)33 |
| InChIKey | KMJUSGYBXKUENE-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.08 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|