C7F15NO — CID 14361493
3-[bis(1,1,2,2,2-pentafluoroethyl)amino]-2,2,3,3-tetrafluoropropanoyl fluoride (PubChem CID 14361493) has the molecular formula C7F15NO and a molecular weight of 399.05 g/mol. Its IUPAC name is 3-[bis(1,1,2,2,2-pentafluoroethyl)amino]-2,2,3,3-tetrafluoropropanoyl fluoride.
| Compound Name | 3-[bis(1,1,2,2,2-pentafluoroethyl)amino]-2,2,3,3-tetrafluoropropanoyl fluoride |
|---|---|
| PubChem CID | 14361493 |
| Molecular Formula | C7F15NO |
| Molecular Weight | 399.05 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | 3-[bis(1,1,2,2,2-pentafluoroethyl)amino]-2,2,3,3-tetrafluoropropanoyl fluoride |
| SMILES | O=C(F)C(F)(F)C(F)(F)N(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7F15NO/c8-1(24)2(9,10)5(17,18)23(6(19,20)3(11,12)13)7(21,22)4(14,15)16 |
| InChIKey | ICPUJJVWXDKRRK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.05 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|