C4BrF7O — CID 12060805
3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride (PubChem CID 12060805) has the molecular formula C4BrF7O and a molecular weight of 276.93 g/mol. Its IUPAC name is 3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride.
| Compound Name | 3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride |
|---|---|
| PubChem CID | 12060805 |
| Molecular Formula | C4BrF7O |
| Molecular Weight | 276.93 g/mol |
| Exact Mass | 275.90 |
| IUPAC Name | 3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride |
| SMILES | O=C(F)C(F)(F)C(F)(Br)C(F)(F)F |
| InChI | InChI=1S/C4BrF7O/c5-3(9,4(10,11)12)2(7,8)1(6)13 |
| InChIKey | PBHPXBIOFYDHJE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.93 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|