3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride

C4BrF7O — CID 12060805

IUPAC3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride
SMILESO=C(F)C(F)(F)C(F)(Br)C(F)(F)F
InChIInChI=1S/C4BrF7O/c5-3(9,4(10,11)12)2(7,8)1(6)13
InChIKeyPBHPXBIOFYDHJE-UHFFFAOYSA-N
MW276.93 g/mol
LogP2.74
Rot. Bonds2

About 3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride

3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride (PubChem CID 12060805) has the molecular formula C4BrF7O and a molecular weight of 276.93 g/mol. Its IUPAC name is 3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride.

Molecular Properties

Compound Name3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride
PubChem CID12060805
Molecular FormulaC4BrF7O
Molecular Weight276.93 g/mol
Exact Mass275.90
IUPAC Name3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride
SMILESO=C(F)C(F)(F)C(F)(Br)C(F)(F)F
InChIInChI=1S/C4BrF7O/c5-3(9,4(10,11)12)2(7,8)1(6)13
InChIKeyPBHPXBIOFYDHJE-UHFFFAOYSA-N
XLogP2.74
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.93
LogP ≤ 52.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride?
The IUPAC name of 3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride (CID 12060805) is 3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride.
What is the SMILES notation for 3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride?
The canonical SMILES for 3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride is O=C(F)C(F)(F)C(F)(Br)C(F)(F)F.
What is the InChIKey of 3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride?
The InChIKey is PBHPXBIOFYDHJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4BrF7O/c5-3(9,4(10,11)12)2(7,8)1(6)13.
What are the key properties of 3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride?
3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride has a molecular weight of 276.93 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,2,3,4,4,4-hexafluorobutanoyl fluoride is sourced from PubChem (CID 12060805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).