C4BrCl3F6 — CID 23236256
3-bromo-1,1,1-trichloro-2,2,3,4,4,4-hexafluorobutane (PubChem CID 23236256) has the molecular formula C4BrCl3F6 and a molecular weight of 348.30 g/mol. Its IUPAC name is 3-bromo-1,1,1-trichloro-2,2,3,4,4,4-hexafluorobutane.
| Compound Name | 3-bromo-1,1,1-trichloro-2,2,3,4,4,4-hexafluorobutane |
|---|---|
| PubChem CID | 23236256 |
| Molecular Formula | C4BrCl3F6 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 345.82 |
| IUPAC Name | 3-bromo-1,1,1-trichloro-2,2,3,4,4,4-hexafluorobutane |
| SMILES | FC(F)(F)C(F)(Br)C(F)(F)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C4BrCl3F6/c5-1(9,4(12,13)14)2(10,11)3(6,7)8 |
| InChIKey | FVWBJTOFOCEDBL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|