2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid

C6HBr2ClF8O2 — CID 170873602

IUPAC2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid
SMILESO=C(O)C(F)(Br)C(F)(F)C(F)(Br)C(F)(Cl)C(F)(F)F
InChIInChI=1S/C6HBr2ClF8O2/c7-2(10,1(18)19)5(13,14)3(8,11)4(9,12)6(15,16)17/h(H,18,19)
InChIKeyFDGGXMVDEBMFPR-UHFFFAOYSA-N
MW452.32 g/mol
LogP4.29
Rot. Bonds4

About 2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid

2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid (PubChem CID 170873602) has the molecular formula C6HBr2ClF8O2 and a molecular weight of 452.32 g/mol. Its IUPAC name is 2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid.

Molecular Properties

Compound Name2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid
PubChem CID170873602
Molecular FormulaC6HBr2ClF8O2
Molecular Weight452.32 g/mol
Exact Mass449.79
IUPAC Name2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid
SMILESO=C(O)C(F)(Br)C(F)(F)C(F)(Br)C(F)(Cl)C(F)(F)F
InChIInChI=1S/C6HBr2ClF8O2/c7-2(10,1(18)19)5(13,14)3(8,11)4(9,12)6(15,16)17/h(H,18,19)
InChIKeyFDGGXMVDEBMFPR-UHFFFAOYSA-N
XLogP4.29
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500452.32
LogP ≤ 54.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid?
The IUPAC name of 2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid (CID 170873602) is 2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid.
What is the SMILES notation for 2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid?
The canonical SMILES for 2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid is O=C(O)C(F)(Br)C(F)(F)C(F)(Br)C(F)(Cl)C(F)(F)F.
What is the InChIKey of 2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid?
The InChIKey is FDGGXMVDEBMFPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6HBr2ClF8O2/c7-2(10,1(18)19)5(13,14)3(8,11)4(9,12)6(15,16)17/h(H,18,19).
What are the key properties of 2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid?
2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid has a molecular weight of 452.32 g/mol, XLogP of 4.29, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid is sourced from PubChem (CID 170873602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).