C6HBr2ClF8O2 — CID 170873602
2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid (PubChem CID 170873602) has the molecular formula C6HBr2ClF8O2 and a molecular weight of 452.32 g/mol. Its IUPAC name is 2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid.
| Compound Name | 2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid |
|---|---|
| PubChem CID | 170873602 |
| Molecular Formula | C6HBr2ClF8O2 |
| Molecular Weight | 452.32 g/mol |
| Exact Mass | 449.79 |
| IUPAC Name | 2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanoic acid |
| SMILES | O=C(O)C(F)(Br)C(F)(F)C(F)(Br)C(F)(Cl)C(F)(F)F |
| InChI | InChI=1S/C6HBr2ClF8O2/c7-2(10,1(18)19)5(13,14)3(8,11)4(9,12)6(15,16)17/h(H,18,19) |
| InChIKey | FDGGXMVDEBMFPR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|