C5HClF8O2 — CID 165364661
2-chloro-2,3,3,4,4,5,5,5-octafluoropentanoic acid (PubChem CID 165364661) has the molecular formula C5HClF8O2 and a molecular weight of 280.50 g/mol. Its IUPAC name is 2-chloro-2,3,3,4,4,5,5,5-octafluoropentanoic acid.
| Compound Name | 2-chloro-2,3,3,4,4,5,5,5-octafluoropentanoic acid |
|---|---|
| PubChem CID | 165364661 |
| Molecular Formula | C5HClF8O2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 279.95 |
| IUPAC Name | 2-chloro-2,3,3,4,4,5,5,5-octafluoropentanoic acid |
| SMILES | O=C(O)C(F)(Cl)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5HClF8O2/c6-2(7,1(15)16)3(8,9)4(10,11)5(12,13)14/h(H,15,16) |
| InChIKey | HYLJOWPWZWWART-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|