C8H3F13O4 — CID 150355855
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2,2-dihydroxyoctanoic acid (PubChem CID 150355855) has the molecular formula C8H3F13O4 and a molecular weight of 410.08 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2,2-dihydroxyoctanoic acid.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2,2-dihydroxyoctanoic acid |
|---|---|
| PubChem CID | 150355855 |
| Molecular Formula | C8H3F13O4 |
| Molecular Weight | 410.08 g/mol |
| Exact Mass | 409.98 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2,2-dihydroxyoctanoic acid |
| SMILES | O=C(O)C(O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H3F13O4/c9-3(10,2(24,25)1(22)23)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h24-25H,(H,22,23) |
| InChIKey | GURVLQDDXGRRRV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.08 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|