(2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid

C5H3F8NO2 — CID 91107544

IUPAC(2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid
SMILESN[C@](F)(C(=O)O)C(F)(F)C(F)(F)C(F)(F)F
InChIInChI=1S/C5H3F8NO2/c6-2(14,1(15)16)3(7,8)4(9,10)5(11,12)13/h14H2,(H,15,16)/t2-/m1/s1
InChIKeyBHGFVFGKZFMEGG-UWTATZPHSA-N
MW261.07 g/mol
LogP1.53
Rot. Bonds3

About (2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid

(2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid (PubChem CID 91107544) has the molecular formula C5H3F8NO2 and a molecular weight of 261.07 g/mol. Its IUPAC name is (2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid.

Molecular Properties

Compound Name(2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid
PubChem CID91107544
Molecular FormulaC5H3F8NO2
Molecular Weight261.07 g/mol
Exact Mass261.00
IUPAC Name(2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid
SMILESN[C@](F)(C(=O)O)C(F)(F)C(F)(F)C(F)(F)F
InChIInChI=1S/C5H3F8NO2/c6-2(14,1(15)16)3(7,8)4(9,10)5(11,12)13/h14H2,(H,15,16)/t2-/m1/s1
InChIKeyBHGFVFGKZFMEGG-UWTATZPHSA-N
XLogP1.53
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.07
LogP ≤ 51.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze (2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid?
The IUPAC name of (2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid (CID 91107544) is (2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid.
What is the SMILES notation for (2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid?
The canonical SMILES for (2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid is N[C@](F)(C(=O)O)C(F)(F)C(F)(F)C(F)(F)F.
What is the InChIKey of (2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid?
The InChIKey is BHGFVFGKZFMEGG-UWTATZPHSA-N. The full InChI is InChI=1S/C5H3F8NO2/c6-2(14,1(15)16)3(7,8)4(9,10)5(11,12)13/h14H2,(H,15,16)/t2-/m1/s1.
What are the key properties of (2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid?
(2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid has a molecular weight of 261.07 g/mol, XLogP of 1.53, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid is sourced from PubChem (CID 91107544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).