C5H3F8NO2 — CID 91107544
(2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid (PubChem CID 91107544) has the molecular formula C5H3F8NO2 and a molecular weight of 261.07 g/mol. Its IUPAC name is (2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid.
| Compound Name | (2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid |
|---|---|
| PubChem CID | 91107544 |
| Molecular Formula | C5H3F8NO2 |
| Molecular Weight | 261.07 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | (2S)-2-amino-2,3,3,4,4,5,5,5-octafluoropentanoic acid |
| SMILES | N[C@](F)(C(=O)O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H3F8NO2/c6-2(14,1(15)16)3(7,8)4(9,10)5(11,12)13/h14H2,(H,15,16)/t2-/m1/s1 |
| InChIKey | BHGFVFGKZFMEGG-UWTATZPHSA-N |
| XLogP | 1.53 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.07 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|