C6Br2ClF8N — CID 98155748
(2S,4R,5S)-2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanenitrile (PubChem CID 98155748) has the molecular formula C6Br2ClF8N and a molecular weight of 433.32 g/mol. Its IUPAC name is (2S,4R,5S)-2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanenitrile.
| Compound Name | (2S,4R,5S)-2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanenitrile |
|---|---|
| PubChem CID | 98155748 |
| Molecular Formula | C6Br2ClF8N |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 430.80 |
| IUPAC Name | (2S,4R,5S)-2,4-dibromo-5-chloro-2,3,3,4,5,6,6,6-octafluorohexanenitrile |
| SMILES | N#C[C@](F)(Br)C(F)(F)[C@@](F)(Br)[C@@](F)(Cl)C(F)(F)F |
| InChI | InChI=1S/C6Br2ClF8N/c7-2(10,1-18)5(13,14)3(8,11)4(9,12)6(15,16)17/t2-,3-,4+/m1/s1 |
| InChIKey | UYAKDDDHGRMLKH-JJYYJPOSSA-N |
| XLogP | 4.73 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|