C4BrClF8 — CID 154151123
2-bromo-1-chloro-1,1,2,3,3,4,4,4-octafluorobutane (PubChem CID 154151123) has the molecular formula C4BrClF8 and a molecular weight of 315.39 g/mol. Its IUPAC name is 2-bromo-1-chloro-1,1,2,3,3,4,4,4-octafluorobutane.
| Compound Name | 2-bromo-1-chloro-1,1,2,3,3,4,4,4-octafluorobutane |
|---|---|
| PubChem CID | 154151123 |
| Molecular Formula | C4BrClF8 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 313.87 |
| IUPAC Name | 2-bromo-1-chloro-1,1,2,3,3,4,4,4-octafluorobutane |
| SMILES | FC(F)(F)C(F)(F)C(F)(Br)C(F)(F)Cl |
| InChI | InChI=1S/C4BrClF8/c5-1(7,3(6,10)11)2(8,9)4(12,13)14 |
| InChIKey | PJDLPZKFMNGPHH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|